Fluorinated ether compound
AssigneeAsahi Glass Company, Limited
InventorsMasao Iwaya, Kazuya Oharu, Hirokazu Takagi, Hidekazu Okamoto
Life of this patent
Estimating the term…
Abstract
A novel fluorinated ether compound useful as an inert medium is provided. The compound is represented by the following formula (1) such as the compound represented by the following formula (1a) or the compound represented by the following formula (1b): RF1OCFRF2CFRF2ORF1 (1) F(CF2)4OCF(CF3)CF(CF3)O(CF2)4F (1a) F(CF2)6OCF(CF3)CF(CF3)O(CF2)6F (1b) wherein the symbols have the following meanings: RF1 is a C4-7 linear perfluoroalkyl group; and RF2 is a fluorine atom or a trifluoromethyl group.
Claims11
A compound represented by the following formula (1):
- RF1OCFRF2CFRF2ORF1 (1)
- wherein the symbols have the following meanings:
- RF1 is a C4-7 linear perfluoroalkyl group;
- and
- RF2 is a trifluoromethyl group.
A method for producing a compound represented by the following formula (1), comprising subjecting two molecules of a compound represented by the following formula (4) to a coupling reaction, or subjecting two molecules of at least one compound selected from the group consisting of a compound represented by the following formula (5) and a compound represented by the following formula (6), to a coupling reaction:
- RF1OCFRF2COF (4)
- RF1OCFRF2COOH (5)
- RF1OCFRF2COOM (6)
- RF1OCFRF2 CFRF2ORF1 (1)
- wherein the symbols have the following meanings:
- RF1 is a C4-7 linear perfluoroalkyl group;
- RF2 is a fluorine atom or a trifluoromethyl group;
- and
- M is an alkali metal atom.
Dependencies are inferred from the claim text.