N4-(3-phenylproprionyl)-2'-deoxycytidine

Abstract

N4-(3-phenylproprionyl)-2'-deoxycytidine derivatives are disclosed having the following formula: ##STR1## wherein R.sup.1 is --CO--CH.sub.2 --CH.sub.2 --C.sub.6 H.sub.5, R.sup.5 is hydrogen, a trityl group or the group --CO--CH.sub.2 --CH.sub.2 --C.sub.6 H.sub.5, R.sup.6 is selected from the group consisting of hydrogen, --CO--CH.sub.2 --CH.sub.2 --C.sub.6 H.sub.5, ##STR2## and R.sup.7 is hydrogen or OH. These derivatives are useful in oligonucleotide synthesis because the 3-phenyl-proprionyl blocking group can be removed rapidly by ammonia.

Dependencies are inferred from the claim text.