Polyfluoroalkyl allyl compound and method for producing the same

Abstract

A polyfluoroalkyl allyl compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CH═CH2  [I] (n: 0 to 5, a: 1 or 2, b: 0 to 3). The polyfluoroalkyl allyl compound is produced by reacting a carboxylic acid allyl adduct represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CHICH2OCOR′  [II] (n, a, and b are as defined above, and R′: a C1-C3 alkyl group) with a transition metal. This method for producing provides a polyfluoroalkyl allyl compound used as a synthetic intermediate for a fluorine-containing alkylsilane compound that can remove free iodine derived from the raw material compound, before a hydrosilylation reaction is performed, without using a metal reagent having a high environmental impact, and that has excellent handling properties.

Dependencies are inferred from the claim text.