Perfluoropolyether compound and lubricant and magnetic disk using same
AssigneeMatsumura Oil Research Corporation
InventorsTamio Akada, Nagayoshi Kobayashi, Yoshinobu Fujii
Life of this patent
Estimating the term…
Abstract
A compound of the formula (I), a lubricant and a magnetic disk using the compound A—CH2CF2O(CF2CF2O)m-(CF2O)n-CF2CH2—B (I) wherein A is amino group having hydroxyl group, B is hydroxyl group, or amino group having or not having hydroxyl group, wherein m is a real number of 5 to 36, and n is a real number of from 4 to 30.
Claims9
A compound of the formula (I)
- A—CH2CF2O(CF2CF2O)m-(CF2O)n-CF2CH2—B (I)
- wherein A is amino group having hydroxyl group, B is hydroxyl group, or amino group having or not having hydroxyl group, wherein m is a real number of 5 to 36, and n is a real number of from 4 to 30.
A lubricant containing the compound of the formula (I)
- A—CH2CF2O(CF2CF2O)m-(CF2O)n-CF2CH2—B (I)
- wherein A is amino group having hydroxyl group, B is hydroxyl group, or amino group having or not having hydroxyl group, wherein m is a real number of 5 to 36, and n is a real number of from 4 to 30.
A magnetic disk comprising a substrate, at least a recording layer and a protective layer formed on the substrate, and a lubrication layer formed thereon from a compound having a perfluoropolyether structure, the magnetic disk being characterized in that the lubrication layer contains the compound of the formula (I)
- A—CH2CF2O(CF2CF2O)m-(CF2O)n-CF2CH2—B (I)
- wherein A is amino group having hydroxyl group, B is hydroxyl group, or amino group having or not having hydroxyl group, wherein m is a real number of 5 to 36, and n is a real number of from 4 to 30.
Dependencies are inferred from the claim text.