Novel fluorinated compound, method for its production and polymer thereof
AssigneeAsahi Glass Company, Limited
InventorsKimiaki Kashiwagi, Gen Ogawa, Masakuni Sato, Kazuya Oharu, Isamu Kaneko, Norihide Sugiyama, Shin Tatematsu
Life of this patent
Estimating the term…
Abstract
A novel polymer useful as an optical resin material excellent in heat resistance, a novel monomer for obtaining the polymer, etc., are provided. A fluorinated diene represented by CF2═CF(CF2)nC(CF3)ROCF═CF2 (wherein R is a fluorine atom or a trifluoromethyl group, and n is an integer of from 1 to 3), and a polymer thereof.
Claims10
A fluorinated diene represented by the formula 1:
- CF2═CF(CF2)nC(CF3)ROCF═CF2 Formula 1
- wherein R is a fluorine atom or a trifluoromethyl group, and n is an integer of from 1 to 3.
A method for producing a fluorinated diene represented by the formula 1, which comprises dehalogenating Z1 and Z2 of a fluorinated compound represented by the formula 2:
- CF2═CF(CF2)nC(CF3)ROCF═CF2 Formula 1 CF2Z1CFZ2(CF2)nC(CF3)ROCF═CF2 Formula 2
- wherein R is a fluorine atom or a trifluoromethyl group, each of Z1 and Z2 which are independent of each other, is a halogen atom other than a fluorine atom, and n is an integer of from 1 to 3.
A polymer comprising monomer units formed by polymerization of a fluorinated diene represented by the formula 1:
- CF2═CF(CF2)nC(CF3)ROCF═CF2 Formula 1
- wherein R is a fluorine atom or a trifluoromethyl group, and n is an integer of from 1 to 3.
Dependencies are inferred from the claim text.